1000339-24-1 Usage
Uses
Used in Organic Synthesis:
3-Cyano-2-fluorophenol is used as a reagent in organic synthesis for the creation of various chemical compounds. Its unique structure allows for selective reactions and functional group manipulations, making it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Processes:
In the chemical industry, 3-Cyano-2-fluorophenol is utilized in various processes due to its reactivity and stability. It can be employed in the production of dyes, pigments, and polymers, where its fluorinated and nitrile functionalities contribute to the desired properties of the final products.
Used in Pharmaceutical Industry:
3-Cyano-2-fluorophenol serves as an intermediate in the development of new pharmaceutical compounds. Its unique structure can be further modified to create drug candidates with potential therapeutic applications, particularly in the areas of anti-inflammatory, analgesic, and anti-cancer treatments.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Cyano-2-fluorophenol is used as a starting material for the synthesis of novel pesticides and herbicides. Its properties can be tailored to target specific pests or weeds, providing an effective and environmentally friendly solution for crop protection.
Overall, 3-Cyano-2-fluorophenol is a versatile compound with a wide range of applications across different industries, primarily due to its unique structural features and reactivity in chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 1000339-24-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,0,3,3 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1000339-24:
(9*1)+(8*0)+(7*0)+(6*0)+(5*3)+(4*3)+(3*9)+(2*2)+(1*4)=71
71 % 10 = 1
So 1000339-24-1 is a valid CAS Registry Number.
InChI:InChI=1S/C7H4FNO/c8-7-5(4-9)2-1-3-6(7)10/h1-3,10H