1000340-01-1 Usage
Uses
Used in Pharmaceutical Industry:
3,5-Dibromo-2-fluoro-4-methylpyridine is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of new drug molecules with potential therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 3,5-Dibromo-2-fluoro-4-methylpyridine is utilized as a building block for the development of new agrochemicals, such as pesticides and herbicides, that can help improve crop protection and yield.
Used in Materials Science:
3,5-Dibromo-2-fluoro-4-methylpyridine has been studied for its potential applications in materials science, where it could contribute to the development of novel materials with specific properties, such as improved thermal stability or chemical resistance.
Safety Considerations:
Due to its potentially hazardous nature, 3,5-Dibromo-2-fluoro-4-methylpyridine should be handled with care in a controlled laboratory setting to ensure the safety of researchers and the environment. Proper safety protocols and equipment should be employed during its synthesis and use.
Check Digit Verification of cas no
The CAS Registry Mumber 1000340-01-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,0,3,4 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1000340-01:
(9*1)+(8*0)+(7*0)+(6*0)+(5*3)+(4*4)+(3*0)+(2*0)+(1*1)=41
41 % 10 = 1
So 1000340-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H4Br2FN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3