10004-39-4 Usage
General Description
4-[5-(2-chlorophenyl)-4-[4-(dimethylamino)phenyl]-oxazol-2-yl]-N,N-dipropyl-aniline is a complex chemical compound that consists of a dipropyl-aniline core with an oxazol-2-yl structural motif and substituents composed of a 2-chlorophenyl group and a dimethylamino-phenyl group. The presence of these substituents imparts specific properties and reactivity to the compound, making it potentially useful in various applications. The 2-chlorophenyl group may confer unique electronic and steric effects, while the dimethylamino-phenyl group could potentially participate in various types of chemical reactions. Overall, this compound represents a potentially valuable building block for the development of new materials or pharmaceuticals, and its structure and reactivity provide opportunities for further exploration and utilization in diverse fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 10004-39-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,0 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10004-39:
(7*1)+(6*0)+(5*0)+(4*0)+(3*4)+(2*3)+(1*9)=34
34 % 10 = 4
So 10004-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C29H32ClN3O/c1-5-19-33(20-6-2)24-17-13-22(14-18-24)29-31-27(21-11-15-23(16-12-21)32(3)4)28(34-29)25-9-7-8-10-26(25)30/h7-18H,5-6,19-20H2,1-4H3