100047-54-9 Usage
Uses
Used in Chemical Industry:
4-Isoxazolecarboxylic acid, 5-methyl-, methyl ester (6CI, 9CI) is used as a chemical intermediate for the synthesis of various compounds due to its unique isoxazole ring structure and ester functional group.
Used in Pharmaceutical Industry:
4-Isoxazolecarboxylic acid, 5-methyl-, methyl ester (6CI, 9CI) is used as a potential drug candidate or a building block in the development of new pharmaceuticals, given its structural features that may contribute to its biological activity.
Used in Fragrance Industry:
4-Isoxazolecarboxylic acid, 5-methyl-, methyl ester (6CI, 9CI) is used as a fragrance ingredient for its sweet or fruity smell, contributing to the creation of various scents in perfumes and other fragranced products.
Note: The specific uses mentioned above are based on the general properties of the compound and its class. Further research and study would be required to determine the exact applications, safety, and toxicity of 4-Isoxazolecarboxylic acid, 5-methyl-, methyl ester (6CI, 9CI).
Check Digit Verification of cas no
The CAS Registry Mumber 100047-54-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,0,4 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 100047-54:
(8*1)+(7*0)+(6*0)+(5*0)+(4*4)+(3*7)+(2*5)+(1*4)=59
59 % 10 = 9
So 100047-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO3/c1-4-5(3-7-10-4)6(8)9-2/h3H,1-2H3
