100047-54-9 Usage
General Description
4-Isoxazolecarboxylic acid, 5-methyl-, methyl ester (6CI, 9CI) is a chemical compound that belongs to the class of organic compounds known as isoxazoles. Isoxazoles are compounds containing an isoxazole ring, which is a five-membered aromatic ring with one oxygen atom, one nitrogen atom, and three carbon atoms. The ester formation suggests the compound has undergone a reaction involving carboxylic acid and an alcohol - in this case, methanol. The "5-methyl" indicates the presence of a methyl substitution at the 5th carbon of the isoxazole ring. Since it is specified as an ester, it likely has a sweet or fruity smell and is typically used in various chemical and pharmaceutical applications. However, details regarding its specific use, safety, or toxicity are limited and would depend on further specific scientific research and study.
Check Digit Verification of cas no
The CAS Registry Mumber 100047-54-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,0,4 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 100047-54:
(8*1)+(7*0)+(6*0)+(5*0)+(4*4)+(3*7)+(2*5)+(1*4)=59
59 % 10 = 9
So 100047-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO3/c1-4-5(3-7-10-4)6(8)9-2/h3H,1-2H3