100047-61-8 Usage
Uses
Used in Pharmaceutical Industry:
4,5-DIMETHYL-ISOXAZOLE-3-CARBOXYLIC ACID is used as a starting material for the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity, contributing to the development of new drugs with potential therapeutic benefits.
Used in Agrochemical Industry:
In the agrochemical sector, 4,5-DIMETHYL-ISOXAZOLE-3-CARBOXYLIC ACID serves as a key intermediate in the production of agrochemicals, aiding in the creation of compounds designed to protect crops and enhance agricultural productivity.
Used in Antimicrobial and Antifungal Applications:
4,5-DIMETHYL-ISOXAZOLE-3-CARBOXYLIC ACID is utilized as an antimicrobial and antifungal agent, leveraging its inherent properties to combat microbial infections and fungal growth, which is particularly relevant in the context of drug development and material preservation.
Used in Materials Science:
4,5-DIMETHYL-ISOXAZOLE-3-CARBOXYLIC ACID is employed as a building block in materials science, where it contributes to the synthesis of a range of organic compounds with potential applications in various industries, including the development of new materials with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 100047-61-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,0,4 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 100047-61:
(8*1)+(7*0)+(6*0)+(5*0)+(4*4)+(3*7)+(2*6)+(1*1)=58
58 % 10 = 8
So 100047-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO3/c1-3-4(2)10-7-5(3)6(8)9/h1-2H3,(H,8,9)
