1000577-24-1 Usage
Uses
Used in Chemical Research:
2,3,4-Trifluoro-6-aminobromobenzene is used as a chemical intermediate for the synthesis of more complex molecules, particularly in the field of organic chemistry. Its unique structure with fluorine, bromine, and amino groups allows for versatile reactivity and potential use in the development of new compounds.
Used in Pharmaceutical Research:
2,3,4-Trifluoro-6-aminobromobenzene is used as a building block in the design and synthesis of new pharmaceutical compounds. Its presence in the molecular structure can influence the properties and activities of the resulting drug candidates, making it a valuable component in the development of novel therapeutic agents.
Used in Material Science:
2,3,4-Trifluoro-6-aminobromobenzene is used as a component in the development of new materials with specific properties, such as improved thermal stability or chemical resistance. Its incorporation into polymers or other materials can lead to enhanced performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1000577-24-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,0,5,7 and 7 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1000577-24:
(9*1)+(8*0)+(7*0)+(6*0)+(5*5)+(4*7)+(3*7)+(2*2)+(1*4)=91
91 % 10 = 1
So 1000577-24-1 is a valid CAS Registry Number.
InChI:InChI=1S/C6H3BrF3N/c7-4-3(11)1-2(8)5(9)6(4)10/h1H,11H2
