10011-39-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Fluoropropenoic acid butyl ester is used as an intermediate in the production of various pharmaceuticals for its ability to facilitate the synthesis of complex organic molecules that are integral to the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Fluoropropenoic acid butyl ester is employed as an intermediate in the synthesis of compounds that are used in the development of pesticides and other agricultural chemicals, contributing to enhanced crop protection and yield.
Used as a Solvent:
2-Fluoropropenoic acid butyl ester is utilized as a solvent in various chemical processes, particularly in organic synthesis, due to its ability to dissolve a wide range of substances and facilitate reactions.
Used as a Reagent in Organic Synthesis:
2-FLUOROPROPENOIC ACID BUTYL ESTER is also used as a reagent in organic synthesis, where it plays a crucial role in the formation of new chemical bonds and the synthesis of target molecules, highlighting its versatility in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 10011-39-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,1 and 1 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10011-39:
(7*1)+(6*0)+(5*0)+(4*1)+(3*1)+(2*3)+(1*9)=29
29 % 10 = 9
So 10011-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H11FO2/c1-3-4-5-10-7(9)6(2)8/h2-5H2,1H3
