100142-73-2 Usage
General Description
3-(1-phenyl-1H-pyrazol-4-yl)propanoic acid is a chemical compound with the molecular formula C14H14N2O2. It is a derivative of pyrazole and belongs to the class of propanoic acids. 3-(1-PHENYL-1H-PYRAZOL-4-YL)PROPANOIC ACID is important in medicinal chemistry as it exhibits potential biological activities and pharmacological properties. It may have potential as an anti-inflammatory agent due to its carboxylic acid group, which is a common feature in many nonsteroidal anti-inflammatory drugs. Additionally, its phenyl and pyrazole moieties suggest possible interactions with biological targets such as enzymes or receptors. Further research and studies on this compound can help in understanding its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 100142-73-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,1,4 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100142-73:
(8*1)+(7*0)+(6*0)+(5*1)+(4*4)+(3*2)+(2*7)+(1*3)=52
52 % 10 = 2
So 100142-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O2/c15-12(16)7-6-10-8-13-14(9-10)11-4-2-1-3-5-11/h1-5,8-9H,6-7H2,(H,15,16)
