100155-73-5 Usage
Uses
Since the provided materials do not specify the uses of 2-Pyridinemethanamine, alpha-ethyl-(9CI), it is not possible to list its applications based on the given information. However, given its classification as a Pyridine derivative, it is likely to have potential applications in various chemical and pharmaceutical processes, similar to other pyridine compounds. Further research or context would be needed to determine its specific uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 100155-73-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,1,5 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100155-73:
(8*1)+(7*0)+(6*0)+(5*1)+(4*5)+(3*5)+(2*7)+(1*3)=65
65 % 10 = 5
So 100155-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2/c1-2-7(9)8-5-3-4-6-10-8/h3-7H,2,9H2,1H3