10023-25-3 Usage
Uses
Used in Pharmaceutical Research:
6,13-Dihydrobenzo[e][1]benzothiopyrano[4,3-b]indole is used as a subject of interest in pharmaceutical research for its potential pharmacological significance and biological activity. Its unique molecular structure and properties make it a promising candidate for drug discovery and development.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6,13-Dihydrobenzo[e][1]benzothiopyrano[4,3-b]indole is used to explore its potential applications and therapeutic potential. Its complex molecular structure and heterocyclic nature may offer new avenues for the design and synthesis of novel therapeutic agents.
Further studies are necessary to elucidate the therapeutic potential of 6,13-Dihydrobenzo[e][1]benzothiopyrano[4,3-b]indole and explore its practical applications in various industries. Its unique properties and potential pharmacological significance make it a valuable compound for ongoing research and development in the pharmaceutical and medicinal chemistry fields.
Check Digit Verification of cas no
The CAS Registry Mumber 10023-25-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,2 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10023-25:
(7*1)+(6*0)+(5*0)+(4*2)+(3*3)+(2*2)+(1*5)=33
33 % 10 = 3
So 10023-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H13NS/c1-2-6-13-12(5-1)9-10-16-18(13)15-11-21-17-8-4-3-7-14(17)19(15)20-16/h1-10,20H,11H2
