10025-06-6 Usage
General Description
9-octadecenyl (Z)-N-methylaminoacetate is a chemical compound with the molecular formula C20H39NO2. It is an N-substituted fatty acid derivative that contains a long hydrocarbon chain and a methylamino group. It is commonly used in the synthesis of various organic compounds, such as pharmaceuticals and surfactants. 9-octadecenyl (Z)-N-methylaminoacetate has potential applications in the fields of medicine, biochemistry, and chemical research. Its chemical properties and structure make it a versatile building block for creating new and complex molecules with unique properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 10025-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,2 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10025-06:
(7*1)+(6*0)+(5*0)+(4*2)+(3*5)+(2*0)+(1*6)=36
36 % 10 = 6
So 10025-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-21(23)20-22-2/h10-11,22H,3-9,12-20H2,1-2H3/b11-10-