1002726-59-1 Usage
General Description
2,2-DIMETHYL-6-NITRO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is a chemical compound with a complex molecular structure. It consists of a pyrido-oxazin ring system with a nitro group and a dimethyl group attached to it. This chemical is a heterocyclic compound, which means it contains at least two different elements in its ring structure. It is also a nitro compound, which indicates the presence of a nitro functional group in its chemical composition. 2,2-DIMETHYL-6-NITRO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE may have potential applications in pharmaceuticals, agrochemicals, or as a research tool in organic chemistry. However, due to its intricate molecular structure, it may also pose certain hazards and risks if not handled and used properly in a controlled environment.
Check Digit Verification of cas no
The CAS Registry Mumber 1002726-59-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,2,7,2 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1002726-59:
(9*1)+(8*0)+(7*0)+(6*2)+(5*7)+(4*2)+(3*6)+(2*5)+(1*9)=101
101 % 10 = 1
So 1002726-59-1 is a valid CAS Registry Number.
InChI:InChI=1S/C9H9N3O4/c1-9(2)8(13)11-7-5(16-9)3-4-6(10-7)12(14)15/h3-4H,1-2H3,(H,10,11,13)