100311-09-9 Usage
Explanation
Different sources of media describe the Explanation of 100311-09-9 differently. You can refer to the following data:
1. The compound is composed of 25 carbon atoms, 38 hydrogen atoms, 2 nitrogen atoms, 4 oxygen atoms, and 1 chlorine atom.
2. It has a positively charged nitrogen atom, which is bonded to four different organic groups, giving it the properties of a quaternary ammonium salt.
3. Presence of a benzoyl group
4. Presence of an oxygen atom
3. The oxygen atom connects the benzoyl group to an ethyl group (C2H5), further building the compound's structure.
5. Presence of an ethyl group
6. Presence of a pentoxy group
4. A pentoxy group (C5H11O) is also part of the compound's structure, which may influence its potential applications and properties.
7. Presence of an amino group
5. The amino group (NH2) is another functional group in the compound, which can participate in various chemical reactions and interactions.
6. The structure of the compound suggests that it may have uses in these fields, possibly as an intermediate in the production of other compounds.
9. Need for further research and testing
7. To determine the exact uses and properties of 2-(4-amino-2-pentoxy-benzoyl)oxyethyl-diethyl-azanium chloride, additional research and testing would be required.
Type of compound
Quaternary ammonium salt
Potential applications
Pharmacology or organic synthesis
Check Digit Verification of cas no
The CAS Registry Mumber 100311-09-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,3,1 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 100311-09:
(8*1)+(7*0)+(6*0)+(5*3)+(4*1)+(3*1)+(2*0)+(1*9)=39
39 % 10 = 9
So 100311-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H30N2O3.ClH/c1-4-7-8-12-22-17-14-15(19)9-10-16(17)18(21)23-13-11-20(5-2)6-3;/h9-10,14H,4-8,11-13,19H2,1-3H3;1H
