100311-13-5 Usage
Properties
1. Molecular formula: C23H38Cl2N2O4
2. Quaternary ammonium compound
3. Contains a benzoyl group and two propoxy groups
4. Surfactant
5. Emulsifier
6. Disinfectant
Specific content
1. Positively charged nitrogen atom
2. Ability to reduce surface tension of a liquid
3. Increases spreading and wetting properties
4. Versatile and valuable chemical
5. Used in various industrial and consumer applications
Check Digit Verification of cas no
The CAS Registry Mumber 100311-13-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,3,1 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100311-13:
(8*1)+(7*0)+(6*0)+(5*3)+(4*1)+(3*1)+(2*1)+(1*3)=35
35 % 10 = 5
So 100311-13-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H28N2O3.2ClH/c1-4-11-21-16-13-14(18)8-9-15(16)17(20)22-12-7-10-19(5-2)6-3;;/h8-9,13H,4-7,10-12,18H2,1-3H3;2*1H