1003709-67-8 Usage
General Description
4-Methoxy-2,3,5-trifluorobenzoic acid is a chemical compound with the molecular formula C8H5F3O3. It is a derivative of benzoic acid and is characterized by the presence of a methoxy group and three fluorine atoms on the benzene ring. 4-METHOXY-2,3,5-TRIFLUOROBENZOIC ACID is commonly used as a building block in organic synthesis and pharmaceutical research. It has potential applications in the development of new drugs and agrochemicals due to its unique structure and properties. Additionally, it may also be used in the production of specialty chemicals and materials. Overall, 4-Methoxy-2,3,5-trifluorobenzoic acid is a versatile chemical with various potential applications in the fields of chemistry and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 1003709-67-8 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,3,7,0 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1003709-67:
(9*1)+(8*0)+(7*0)+(6*3)+(5*7)+(4*0)+(3*9)+(2*6)+(1*7)=108
108 % 10 = 8
So 1003709-67-8 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5F3O3/c1-14-7-4(9)2-3(8(12)13)5(10)6(7)11/h2H,1H3,(H,12,13)
