10039-34-6 Usage
General Description
Dipotassium ethylene bis(dithiocarbamate) is a chemical compound with the molecular formula C5H8K2N2S4. It is commonly used as a fungicide to control various diseases in agriculture, particularly in the protection of fruits and vegetables. It works by inhibiting the enzyme activity in fungi, ultimately leading to their death. However, it has also been linked to potential health risks, such as skin and eye irritation, and it may pose a risk to aquatic organisms if it enters water systems. Therefore, proper handling and disposal of dipotassium ethylene bis(dithiocarbamate) are essential to minimize its potential negative impact on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 10039-34-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,3 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10039-34:
(7*1)+(6*0)+(5*0)+(4*3)+(3*9)+(2*3)+(1*4)=56
56 % 10 = 6
So 10039-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N2S4.2K/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);;/q;2*+1/p-2