1004-21-3 Usage
General Description
The chemical 2-(2-oxo-4-imidazolin-4-yl)ethylamine, also known as histamine, is a biogenic amine that plays a crucial role in the body's immune response and inflammatory processes. It is produced by mast cells and basophils and acts as a neurotransmitter, regulating various physiological functions including gastric acid secretion, smooth muscle contraction, and vasodilation. Histamine is also involved in allergic reactions and is responsible for the symptoms of allergies, such as itching, sneezing, and runny nose. Additionally, it is a key mediator in the body's response to tissue injury and infection. Histamine receptors are widely distributed throughout the body, and drugs that target these receptors are used in the treatment of various conditions, including allergic reactions, motion sickness, and gastric disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 1004-21-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1004-21:
(6*1)+(5*0)+(4*0)+(3*4)+(2*2)+(1*1)=23
23 % 10 = 3
So 1004-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3O/c6-2-1-4-3-7-5(9)8-4/h3H,1-2,6H2,(H2,7,8,9)