10043-09-1 Usage
General Description
2,3-Bis(oxiranylmethyl)-1,4-dioxane, also known as 1,4-Dioxane-2,3-dimethanol diglycidyl ether, is a chemical compound used as a reactive diluent in the formulation of epoxy resins. It is characterized by its two epoxide functional groups, which make it a versatile crosslinking agent in various industrial applications. 2,3-Bis(oxiranylmethyl)-1,4-dioxane is widely used in the production of adhesives, coatings, and composites due to its ability to improve the mechanical and thermal properties of the resulting materials. However, 2,3-Bis(oxiranylmethyl)-1,4-dioxane has been associated with potential health and environmental risks, as it is considered a possible human carcinogen and has been detected as a contaminant in groundwater and drinking water sources. Therefore, its use and handling require careful consideration and adherence to safety protocols to minimize any potential adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 10043-09-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,4 and 3 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10043-09:
(7*1)+(6*0)+(5*0)+(4*4)+(3*3)+(2*0)+(1*9)=41
41 % 10 = 1
So 10043-09-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O6/c1-2-12-10(16-6-8-4-14-8)9(11-1)15-5-7-3-13-7/h7-10H,1-6H2
