100447-55-0 Usage
Structure
Contains a benzodioxane ring, a carboxylic acid group, a phenyl group, an ethoxyethyl ester, and diethylamino functional groups.
Configuration
(E)configuration, indicating the arrangement of the double bond in the molecule.
Functional Groups
Carboxylic acid, phenyl, ethoxyethyl ester, and diethylamino.
Form
Citrate, which is a salt or ester of citric acid.
Application
Potential use in the pharmaceutical industry for the development of drugs for various therapeutic uses.
Handling
Should be handled with caution due to its complex and potentially reactive nature.
Reactivity
The presence of multiple functional groups may lead to various chemical reactions with other compounds.
Solubility
Not specified in the material provided, but it may be soluble in organic solvents due to its nonpolar components.
Stability
The stability of the compound may depend on factors such as temperature, pH, and the presence of other reactive substances.
Check Digit Verification of cas no
The CAS Registry Mumber 100447-55-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,4,4 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 100447-55:
(8*1)+(7*0)+(6*0)+(5*4)+(4*4)+(3*7)+(2*5)+(1*5)=80
80 % 10 = 0
So 100447-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H29NO5.C6H8O7/c1-3-24(4-2)14-15-26-16-17-27-23(25)22-21(18-10-6-5-7-11-18)28-19-12-8-9-13-20(19)29-22;7-2-6(4(10)11,5(12)13)1-3(8)9/h5-13,21-22H,3-4,14-17H2,1-2H3;7H,1-2H2,(H,8,9)(H,10,11)(H,12,13)/t21-,22+;/m0./s1