100501-59-5 Usage
General Description
2-METHYL-4,5,6,7-TETRAHYDRO-2H-PYRAZOLO[4,3-C]PYRIDINE, also known as THPP, is a chemical compound with a unique molecular structure that consists of a pyrazolo[4,3-c]pyridine ring system. It has a methyl group attached to the second carbon atom, giving it the 2-methyl prefix. THPP is a heterocyclic compound that is often used in the pharmaceutical industry for the development of potential drug candidates due to its ability to interact with biological targets in the body. It has shown potential as an analgesic, anticonvulsant, and anti-inflammatory agent, and is also being studied for its potential use in the treatment of neurodegenerative diseases. THPP is a versatile compound with a range of potential applications in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 100501-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,5,0 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 100501-59:
(8*1)+(7*0)+(6*0)+(5*5)+(4*0)+(3*1)+(2*5)+(1*9)=55
55 % 10 = 5
So 100501-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3/c1-10-5-6-4-8-3-2-7(6)9-10/h5,8H,2-4H2,1H3