10058-20-5 Usage
General Description
Succinic acid bis[2-(hexyloxy)ethyl] ester is a chemical compound that is commonly used as a plasticizer in the production of various materials, such as adhesives, sealants, and coatings. It is derived from succinic acid and 2-(hexyloxy)ethanol, and it is known for its ability to improve the flexibility and durability of polymers, making them more resistant to heat and chemicals. This chemical is also used in the manufacturing of consumer products, such as food packaging, medical devices, and personal care items. Additionally, it is considered to be a low-toxicity and environmentally friendly plasticizer, making it a popular choice for industries looking to reduce their environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 10058-20-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,5 and 8 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 10058-20:
(7*1)+(6*0)+(5*0)+(4*5)+(3*8)+(2*2)+(1*0)=55
55 % 10 = 5
So 10058-20-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H38O6/c1-3-5-7-9-13-23-15-17-25-19(21)11-12-20(22)26-18-16-24-14-10-8-6-4-2/h3-18H2,1-2H3