100594-13-6 Usage
Description
2-AMINO-4-IODO-6-METHOXYPYRIMIDINE is an organic compound with the molecular formula C5H6IN3O2. It is a heterocyclic compound characterized by the presence of an amino group, an iodine atom, and a methoxy group attached to a pyrimidine ring. 2-AMINO-4-IODO-6-METHOXYPYRIMIDINE is known for its potential applications in the pharmaceutical and chemical industries due to its unique structural features and reactivity.
Uses
Used in Pharmaceutical Industry:
2-AMINO-4-IODO-6-METHOXYPYRIMIDINE is used as a reactant in the synthetic preparation of sulfonylureas, which are known for their antifungal activity. These compounds act as potent inhibitors of Candida albicans acetohydroxyacid synthase, an enzyme involved in the biosynthesis of isoleucine and valine. By inhibiting this enzyme, sulfonylureas can effectively combat fungal infections caused by Candida albicans.
In the synthesis of these antifungal agents, 2-AMINO-4-IODO-6-METHOXYPYRIMIDINE serves as a key building block, contributing to the overall structure and activity of the final product. Its unique combination of functional groups allows for further chemical modifications and optimizations, potentially leading to the development of more effective and targeted antifungal drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 100594-13-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,5,9 and 4 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100594-13:
(8*1)+(7*0)+(6*0)+(5*5)+(4*9)+(3*4)+(2*1)+(1*3)=86
86 % 10 = 6
So 100594-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H6IN3O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3,(H2,7,8,9)
