1006-31-1 Usage
Uses
1. Used in Chemical Analysis:
1,2,4,5-tetrachloro-3-Methylbenzene is used as a reference standard in chemical analysis for its distinct chemical properties. It serves as a benchmark for comparing the behavior of other compounds under specific conditions, such as reaction rates, solubility, and volatility.
2. Used in Environmental Studies:
In environmental studies, 1,2,4,5-tetrachloro-3-Methylbenzene is used as a reference compound to understand the behavior of similar chlorinated aromatic compounds in the environment. This helps in assessing their potential impact on ecosystems and developing strategies for their remediation.
3. Used in Industrial Research:
1,2,4,5-tetrachloro-3-Methylbenzene is employed as a reference material in industrial research, particularly in the development of new chemical processes and the synthesis of novel compounds. Its unique properties make it a valuable tool for understanding reaction mechanisms and optimizing reaction conditions.
4. Used in Quality Control:
In the quality control of chemical products, 1,2,4,5-tetrachloro-3-Methylbenzene is used as a reference standard to ensure the purity and consistency of manufactured products. It helps in the development of accurate analytical methods and the establishment of quality control standards.
5. Used in Educational Purposes:
1,2,4,5-tetrachloro-3-Methylbenzene is utilized as a teaching aid in educational settings, particularly in chemistry and environmental science courses. It provides students with a practical example of a chlorinated aromatic compound and helps them understand the principles of chemical structure, reactivity, and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 1006-31-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 6 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1006-31:
(6*1)+(5*0)+(4*0)+(3*6)+(2*3)+(1*1)=31
31 % 10 = 1
So 1006-31-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Cl4/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,1H3
