100683-81-6 Usage
Description
5-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxybenzo[b]thiophene-2-carboxamide dihydrochloride is a complex organic molecule with potential pharmacological properties. It features a benzo[b]thiophene ring with an amino group, a pyrrolidin-2-ylmethyl side chain, and a carboxamide functional group. The dihydrochloride salt form enhances its solubility and stability, making it a promising candidate for medicinal chemistry and drug development.
Used in Pharmaceutical Industry:
5-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxybenzo[b]thiophene-2-carboxamide dihydrochloride is used as a potential therapeutic agent for certain diseases or conditions due to its unique molecular structure and pharmacological properties.
Used in Neuropharmacology Research:
In the field of neuropharmacology, 5-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxybenzo[b]thiophene-2-carboxamide dihydrochloride is used as a research compound to explore its potential effects on the nervous system and its possible applications in treating neurological disorders.
Further research and analysis are required to fully understand the properties and potential uses of this chemical compound, as its exact applications and mechanisms of action are not yet fully known.
Check Digit Verification of cas no
The CAS Registry Mumber 100683-81-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,6,8 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 100683-81:
(8*1)+(7*0)+(6*0)+(5*6)+(4*8)+(3*3)+(2*8)+(1*1)=96
96 % 10 = 6
So 100683-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N3O2S.2ClH/c1-3-20-8-4-5-12(20)10-19-17(21)16-15(22-2)13-9-11(18)6-7-14(13)23-16;;/h6-7,9,12H,3-5,8,10,18H2,1-2H3,(H,19,21);2*1H