1007-06-3 Usage
Uses
Given the limited information available on 5-(2-Cyanoethyl)hydantoin, its specific applications are not clearly defined. However, based on its chemical structure and properties, potential uses in various industries could include:
Used in Pharmaceutical Industry:
5-(2-Cyanoethyl)hydantoin could be used as an intermediate in the synthesis of pharmaceutical compounds for [specific medical conditions or treatments], due to its unique functional groups that may facilitate chemical reactions and the formation of bioactive molecules.
Used in Chemical Research:
In the field of chemical research, 5-(2-Cyanoethyl)hydantoin may serve as a subject for studying its reactivity, stability, and potential interactions with other molecules. This could contribute to a better understanding of its properties and possible applications in various chemical processes.
Used in Material Science:
The cyanoethyl group in 5-(2-Cyanoethyl)hydantoin may offer specific properties that could be exploited in the development of new materials with unique characteristics. For example, it could be used as a component in the synthesis of polymers or other materials with specific mechanical, electrical, or thermal properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1007-06-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1007-06:
(6*1)+(5*0)+(4*0)+(3*7)+(2*0)+(1*6)=33
33 % 10 = 3
So 1007-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O2/c7-3-1-2-4-5(10)9-6(11)8-4/h4H,1-2H2,(H2,8,9,10,11)
