10071-13-3 Usage
Uses
Used in Pharmaceutical Industry:
6-Amino-3(2H)-pyridazinone is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to be incorporated into complex molecular structures, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Amino-3(2H)-pyridazinone serves as an intermediate in the production of pesticides and other crop protection agents, leveraging its chemical properties to enhance the effectiveness of these products.
Used in Antimicrobial Applications:
6-Amino-3(2H)-pyridazinone is utilized as an antimicrobial agent due to its ability to inhibit the growth of microorganisms, making it a valuable component in the development of new antibiotics and antifungal agents.
Used in Antiviral Applications:
6-Amino-3(2H)-pyridazinone is applied as an antiviral agent, harnessing its potential to interfere with viral replication and infection processes, thus contributing to the creation of novel antiviral medications.
Used in Antitumor Applications:
6-Amino-3(2H)-pyridazinone is explored for its antitumor properties, where it may be used in the development of chemotherapeutic agents targeting the inhibition of tumor growth and progression.
Used in Drug Discovery and Development:
Due to its diverse chemical reactivity and potential biological activities, 6-Amino-3(2H)-pyridazinone is employed in drug discovery and development processes, where it may lead to the creation of innovative therapeutic agents across various medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 10071-13-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,7 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10071-13:
(7*1)+(6*0)+(5*0)+(4*7)+(3*1)+(2*1)+(1*3)=43
43 % 10 = 3
So 10071-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O/c5-3-1-2-4(8)7-6-3/h1-2H,(H2,5,6)(H,7,8)
