100868-45-9 Usage
Description
3,5-dichloro-2-Methylpyridine is a halopyridine chemical compound characterized by a pyridine ring with molecular formula C6H5Cl2N. It features two chlorine atoms at the third and fifth positions and a methyl group at the second position, contributing to its unique chemical properties and applications in various industries.
Uses
Used in Pharmaceutical Industry:
3,5-dichloro-2-Methylpyridine is used as a key intermediate in the synthesis of various pharmaceutical products for its ability to be incorporated into complex organic molecules, enhancing their therapeutic properties and effectiveness in treating different medical conditions.
Used in Agricultural Industry:
3,5-dichloro-2-Methylpyridine is utilized as a building block in the development of agricultural chemicals, such as pesticides and herbicides, due to its potential to improve the efficacy and selectivity of these products in controlling pests and unwanted plant growth.
Check Digit Verification of cas no
The CAS Registry Mumber 100868-45-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,8,6 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 100868-45:
(8*1)+(7*0)+(6*0)+(5*8)+(4*6)+(3*8)+(2*4)+(1*5)=109
109 % 10 = 9
So 100868-45-9 is a valid CAS Registry Number.
InChI:1S/C6H5Cl2N/c1-4-6(8)2-5(7)3-9-4/h2-3H,1H3