10089-09-5 Usage
General Description
Cyclo(L-Abu-L-Ser-L-Ser-3β,4β-dichloro-L-Pro-3-phenyl-βAla-) is a complex chemical compound that is composed of a cyclic peptide chain. It includes amino acids such as L-Abu, L-Ser, 3β,4β-dichloro-L-Pro, and 3-phenyl-βAla. Cyclo(L-Abu-L-Ser-L-Ser-3β,4β-dichloro-L-Pro-3-phenyl-βAla-) is known for its potential pharmaceutical properties and has been studied for its potential applications in drug development and medicinal chemistry. The specific arrangement and combination of these amino acids in the cyclic structure of Cyclo(L-Abu-L-Ser-L-Ser-3β,4β-dichloro-L-Pro-3-phenyl-βAla-) contribute to its unique properties and potential pharmacological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 10089-09-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,8 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10089-09:
(7*1)+(6*0)+(5*0)+(4*8)+(3*9)+(2*0)+(1*9)=75
75 % 10 = 5
So 10089-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H31Cl2N5O7/c1-2-14-21(35)29-16(10-32)22(36)30-17(11-33)24(38)31-9-13(25)19(26)20(31)23(37)28-15(8-18(34)27-14)12-6-4-3-5-7-12/h3-7,13-17,19-20,32-33H,2,8-11H2,1H3,(H,27,34)(H,28,37)(H,29,35)(H,30,36)