10089-93-7 Usage
Uses
Used in Pharmaceutical Industry:
3-hydroxy-N,N-bis(2-hydroxyethyl)-2-naphthamide is used as a versatile building block for the synthesis of various drugs and biologically active molecules. Its unique structure and functional groups make it a valuable component in the development of new pharmaceuticals.
Used as a Chelating Agent:
In the field of chemistry, 3-hydroxy-N,N-bis(2-hydroxyethyl)-2-naphthamide serves as a chelating agent for metal ions. Its ability to form complexes with metal ions is useful in various applications, such as in analytical chemistry and environmental remediation.
Used as a Ligand in Coordination Chemistry:
3-hydroxy-N,N-bis(2-hydroxyethyl)-2-naphthamide also functions as a ligand in coordination chemistry. Its interaction with metal ions can lead to the formation of coordination compounds with potential applications in catalysis, materials science, and other areas of chemistry.
Overall, 3-hydroxy-N,N-bis(2-hydroxyethyl)-2-naphthamide has diverse applications in the field of chemistry and pharmacology, making it an important compound for researchers and industry professionals.
Check Digit Verification of cas no
The CAS Registry Mumber 10089-93-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,8 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10089-93:
(7*1)+(6*0)+(5*0)+(4*8)+(3*9)+(2*9)+(1*3)=87
87 % 10 = 7
So 10089-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO4/c17-7-5-16(6-8-18)15(20)13-9-11-3-1-2-4-12(11)10-14(13)19/h1-4,9-10,17-19H,5-8H2
