1009-85-4 Usage
Uses
Used in Pharmaceutical Industry:
Piperazine, 1,4-bis(2-chloroethyl)(6CI,7CI,8CI,9CI) is used as a chemical intermediate for the synthesis of certain drugs, primarily in the pharmaceutical industry. Its role in drug synthesis is crucial due to its ability to contribute to the development of antineoplastic agents, which are essential in combating cancer.
Used in Cancer Treatment Research:
In the field of oncology, Piperazine, 1,4-bis(2-chloroethyl)(6CI,7CI,8CI,9CI) is studied for its potential use as an anticancer agent. It is employed in research for its capacity to inhibit the growth of cancer cells, making it a promising candidate for further investigation into its therapeutic applications against various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 1009-85-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1009-85:
(6*1)+(5*0)+(4*0)+(3*9)+(2*8)+(1*5)=54
54 % 10 = 4
So 1009-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H16Cl2N2/c9-1-3-11-5-7-12(4-2-10)8-6-11/h1-8H2
