100938-10-1 Usage
Uses
Used in Pharmaceutical Industry:
Amastatin Hydrochloride is used as a pharmaceutical compound for its potent inhibitory effects on specific aminopeptidases. Its selective inhibition of these enzymes makes it a valuable tool in the development of drugs targeting various diseases and conditions.
Used in Research Applications:
In the field of research, Amastatin Hydrochloride serves as a valuable reagent for studying the function and role of aminopeptidases in biological processes. Its ability to selectively inhibit certain APs allows researchers to investigate the specific pathways and mechanisms involved in various cellular functions and diseases.
Used in Drug Development:
Amastatin Hydrochloride is used as a lead compound in the development of new drugs targeting aminopeptidases. Its unique properties and specificity make it a promising candidate for the creation of novel therapeutic agents for a range of medical conditions.
Used in Diagnostic Applications:
Amastatin Hydrochloride can be employed in diagnostic applications to identify and measure the activity of specific aminopeptidases in biological samples. This can be useful in the detection and monitoring of certain diseases or conditions where the activity of these enzymes is altered.
Biochem/physiol Actions
It inhibits cytosolic leucine aminopeptidase (EC.3.4.11.1), microsomal aminopeptidase M (EC.3.4.11.2) and bacterial leucine aminopeptidase (EC.3.4.11.10). It is less effective against aminopeptidase A (EC 3.4.11.7), the enzyme that converts angiotensin II to angiotensin III. Potentiates the CNS effects of vasopressin and oxytocin in vivo.Effective concentration: 1-10 μM.
Check Digit Verification of cas no
The CAS Registry Mumber 100938-10-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,3 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 100938-10:
(8*1)+(7*0)+(6*0)+(5*9)+(4*3)+(3*8)+(2*1)+(1*0)=91
91 % 10 = 1
So 100938-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C21H38N4O8.ClH/c1-9(2)7-12(22)17(28)20(31)25-16(11(5)6)19(30)24-15(10(3)4)18(29)23-13(21(32)33)8-14(26)27;/h9-13,15-17,28H,7-8,22H2,1-6H3,(H,23,29)(H,24,30)(H,25,31)(H,26,27)(H,32,33);1H/t12-,13+,15+,16+,17+;/m1./s1