10095-20-2 Usage
General Description
2,3-Dihydroxypropyl Acrylate is a chemical compound primarily used as a monomer or a building block in the production of polymers or large molecules. It can react with other substances to form a polymer that is beneficial in various industries such as plastics, adhesives, coatings, and sealants due to its adhesive and binding properties. It is in liquid form with a slightly sweet odor. Given its uses, it requires careful handling as it could lead to skin or eye irritation upon contact, respiratory irritation when inhaled, and other potential health effects.
Check Digit Verification of cas no
The CAS Registry Mumber 10095-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,9 and 5 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 10095-20:
(7*1)+(6*0)+(5*0)+(4*9)+(3*5)+(2*2)+(1*0)=62
62 % 10 = 2
So 10095-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10O4/c1-2-6(9)10-4-5(8)3-7/h2,5,7-8H,1,3-4H2
