100957-76-4 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(1H-Indol-3-ylmethyl)piperidine-4-carboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new drugs with diverse therapeutic applications. 1-(1H-Indol-3-ylmethyl)piperidine-4-carboxylic acid's structural components, particularly the indole and piperidine rings, are integral to its role in creating molecules with specific biological activities.
Used in Medicinal Chemistry Research:
In the realm of medicinal chemistry, 1-(1H-Indol-3-ylmethyl)piperidine-4-carboxylic acid is employed as a research chemical to explore its potential as a biologically active molecule. Its presence in the synthesis of compounds that may interact with serotonin receptors positions it as a candidate for further investigation into its agonist or antagonist properties, which could lead to advancements in the treatment of various disorders related to serotonin signaling.
Used in Drug Discovery:
1-(1H-Indol-3-ylmethyl)piperidine-4-carboxylic acid is leveraged in drug discovery processes to identify and optimize lead compounds with therapeutic potential. Its unique structure allows for the design of molecules that can target specific biological pathways, offering a promising avenue for the creation of innovative treatments for a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 100957-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,5 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 100957-76:
(8*1)+(7*0)+(6*0)+(5*9)+(4*5)+(3*7)+(2*7)+(1*6)=114
114 % 10 = 4
So 100957-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O2/c18-15(19)11-5-7-17(8-6-11)10-12-9-16-14-4-2-1-3-13(12)14/h1-4,9,11,16H,5-8,10H2,(H,18,19)
