101-69-9 Usage
General Description
Variamine Blue B Diazonium Salt is a chemical compound often used in the field of organic chemistry and colorant industries. It belongs to the class of diazonium salts, which are known for their versatile reactivity in chemical reactions. This compound typically contains a diazonium group (-N2+) attached to an aromatic ring structure. Its reactivity enables it to form various azo compounds through diazo coupling reactions with other aromatic compounds, resulting in a wide range of vibrant colors used in textiles, inks, and other products.
Uses
Variamine Blue B Diazonium Salt [for Biochemical Research] used in preparation of monocationic monochromophoric hydrazones containing Benzimidazolium unit for hair dyes.
Check Digit Verification of cas no
The CAS Registry Mumber 101-69-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 101-69:
(5*1)+(4*0)+(3*1)+(2*6)+(1*9)=29
29 % 10 = 9
So 101-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N3O.ClH/c1-17-13-8-6-11(7-9-13)15-10-2-4-12(16-14)5-3-10;/h2-9,15H,1H3;1H/q+1;/p-1