101012-16-2 Usage
Uses
Used in Pharmaceutical Industry:
5-Chloro-thiazole-2-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its potential biological activities. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Chloro-thiazole-2-carboxylic acid is utilized as a building block for the creation of novel agrochemicals, such as pesticides and herbicides, due to its ability to impart specific biological activities to these compounds.
Used in Research and Development:
5-Chloro-thiazole-2-carboxylic acid is employed as a research compound for exploring its potential biological activities and applications in various fields. Its unique structure and reactivity make it a valuable tool for scientific investigations and the development of new chemical entities.
Used as an Intermediate in Organic Synthesis:
5-Chloro-thiazole-2-carboxylic acid serves as an intermediate in the production of other organic compounds, leveraging its reactivity and functional groups to facilitate the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 101012-16-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,1 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 101012-16:
(8*1)+(7*0)+(6*1)+(5*0)+(4*1)+(3*2)+(2*1)+(1*6)=32
32 % 10 = 2
So 101012-16-2 is a valid CAS Registry Number.
InChI:InChI=1S/C4H2ClNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)
