101020-79-5 Usage
Uses
Used in Pharmaceutical Industry:
Ademetionine 1,4-butanedisulfonate is used as a precursor in the synthesis of SAMe salts for various pharmaceutical applications. SAMe salts are known for their potential therapeutic benefits, including the treatment of osteoarthritis, depression, and liver diseases. Ademetionine 1,4-butanedisulfonate plays a crucial role in the production of these beneficial salts, contributing to their effectiveness and widespread use in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 101020-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,2 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 101020-79:
(8*1)+(7*0)+(6*1)+(5*0)+(4*2)+(3*0)+(2*7)+(1*9)=45
45 % 10 = 5
So 101020-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H22N6O5S.C4H10O6S2/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21;5-11(6,7)3-1-2-4-12(8,9)10/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25);1-4H2,(H,5,6,7)(H,8,9,10)/t7?,8-,10-,11-,14-,27?;/m1./s1