10105-60-9 Usage
Uses
Used in Chemical Synthesis:
1,2-Dibromo-3,5-difluorobenzene is used as a key intermediate in the synthesis of various organic compounds. Its high reactivity, due to the presence of multiple halogen atoms, makes it a valuable building block for the creation of new molecules and materials.
Used in Pharmaceutical Industry:
1,2-Dibromo-3,5-difluorobenzene is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and reactivity allow for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
1,2-Dibromo-3,5-difluorobenzene is utilized in the synthesis of agrochemicals, such as pesticides and herbicides. Its properties enable the development of effective and targeted chemical solutions for agricultural use.
Used in Dye and Pigment Industry:
1,2-Dibromo-3,5-difluorobenzene is employed in the production of dyes and pigments due to its unique chemical structure. It contributes to the creation of vibrant and stable colorants for various applications, including textiles, plastics, and coatings.
Used in Polymer Industry:
1,2-Dibromo-3,5-difluorobenzene is used as a monomer or intermediate in the synthesis of polymers with specific properties. Its incorporation into polymer structures can enhance characteristics such as thermal stability, flame retardancy, and chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 10105-60-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,0 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 10105-60:
(7*1)+(6*0)+(5*1)+(4*0)+(3*5)+(2*6)+(1*0)=39
39 % 10 = 9
So 10105-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2F2/c7-4-1-3(9)2-5(10)6(4)8/h1-2H
