101077-18-3 Usage
Uses
As the provided materials do not specify the exact applications of 2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-methanol, the following uses are inferred based on its classification as a pharmaceutical compound and its unique molecular structure:
Used in Pharmaceutical Industry:
2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-methanol is used as a potential therapeutic agent for [specific medical conditions or diseases] due to its unique molecular structure and pharmacological properties.
Used in Medicinal Chemistry Research:
2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine-9-methanol serves as a subject of study for understanding its pharmacological properties, mechanism of action, and potential applications in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 101077-18-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,7 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 101077-18:
(8*1)+(7*0)+(6*1)+(5*0)+(4*7)+(3*7)+(2*1)+(1*8)=73
73 % 10 = 3
So 101077-18-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO/c15-9-10-7-11-3-1-5-14-6-2-4-12(8-10)13(11)14/h7-8,15H,1-6,9H2
