10114-48-4 Usage
General Description
4-hydroxy-1-methyl-3-[(2-nitrophenyl)azo]-2-quinolone is a chemical compound with a complex structure, consisting of a quinoline ring with a hydroxyl group and a methyl substituent. It also contains a nitrophenylazo group, which is a common red dye. 4-hydroxy-1-methyl-3-[(2-nitrophenyl)azo]-2-quinolone may have potential applications in the pharmaceutical, dye, or chemical industries, as it possesses unique structural and chemical properties. However, due to its complex structure and potential reactivity, careful handling and further research may be necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 10114-48-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,1 and 4 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10114-48:
(7*1)+(6*0)+(5*1)+(4*1)+(3*4)+(2*4)+(1*8)=44
44 % 10 = 4
So 10114-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H12N4O4/c1-19-12-8-4-2-6-10(12)15(21)14(16(19)22)18-17-11-7-3-5-9-13(11)20(23)24/h2-9,17H,1H3/b18-14-