10119-01-4 Usage
General Description
Z-HIS-PHE-TRP-OET is a chemical compound that consists of four amino acids - histidine, phenylalanine, tryptophan, and ethyl ester. Each of these amino acids has unique properties and roles in biological processes. Histidine is involved in the formation of metal-binding sites in proteins and has a role in enzyme catalysis and in the immune response. Phenylalanine is an essential amino acid that is important for the production of neurotransmitters like dopamine and norepinephrine. Tryptophan is also an essential amino acid and is a precursor for the synthesis of serotonin and melatonin. The ethyl ester group is a chemical derivative used for various purposes, including as a solvent, flavoring agent, and fragrance. As a whole, Z-HIS-PHE-TRP-OET represents a combination of these amino acids and the ethyl ester group, with potential applications in various fields such as pharmaceuticals, food, and cosmetics.
Check Digit Verification of cas no
The CAS Registry Mumber 10119-01-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,1 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10119-01:
(7*1)+(6*0)+(5*1)+(4*1)+(3*9)+(2*0)+(1*1)=44
44 % 10 = 4
So 10119-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C36H38N6O6/c1-2-47-35(45)32(18-26-20-38-29-16-10-9-15-28(26)29)41-33(43)30(17-24-11-5-3-6-12-24)40-34(44)31(19-27-21-37-23-39-27)42-36(46)48-22-25-13-7-4-8-14-25/h3-16,20-21,23,30-32,38H,2,17-19,22H2,1H3,(H,37,39)(H,40,44)(H,41,43)(H,42,46)