101193-40-2 Usage
General Description
Quinotolast is a synthetic organic compound that belongs to the family of quinolones. It is a derivative of the antibiotic norfloxacin and is primarily used as a broad-spectrum antibacterial and antifungal agent. Quinotolast is known for its ability to inhibit the growth of a wide range of bacteria and fungi by targeting their DNA gyrase and topoisomerase enzymes. It is commonly used in the treatment of various bacterial infections, including respiratory, urinary tract, and skin infections. Additionally, quinotolast has shown potential in the management of fungal infections, particularly those caused by Candida species. However, due to its potential for causing adverse effects, quinotolast is generally recommended to be used under medical supervision and after proper diagnosis of the specific infection.
Check Digit Verification of cas no
The CAS Registry Mumber 101193-40-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,1,9 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 101193-40:
(8*1)+(7*0)+(6*1)+(5*1)+(4*9)+(3*3)+(2*4)+(1*0)=72
72 % 10 = 2
So 101193-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H12N6O3/c24-15(18-17-19-21-22-20-17)12-10-14(26-11-6-2-1-3-7-11)13-8-4-5-9-23(13)16(12)25/h1-10H,(H2,18,19,20,21,22,24)