1012-35-7 Usage
Description
1-Acetyl-1,3-diazaspiro[4.4]nonane-2,4-dione is a unique chemical compound characterized by its spirocyclic ring system and the presence of both a diazaspiro and a diester functional group. As an organic compound, it holds potential in pharmaceutical and medicinal chemistry due to the diverse biological activities often associated with spirocyclic compounds. The acetyl group in its structure implies a degree of chemical reactivity, suggesting the possibility of various chemical transformations. Further exploration is required to uncover its full spectrum of properties and applications across scientific and industrial domains.
Uses
Used in Pharmaceutical and Medicinal Chemistry:
1-Acetyl-1,3-diazaspiro[4.4]nonane-2,4-dione is utilized as a compound with potential biological activities for the development of pharmaceuticals and medicines. Its unique structure and functional groups contribute to its potential as a candidate for therapeutic applications.
Used in Chemical Research and Development:
Due to its chemical reactivity and the presence of the acetyl group, 1-Acetyl-1,3-diazaspiro[4.4]nonane-2,4-dione is used as a subject of study in chemical research to explore its potential for undergoing chemical transformations and its applicability in the synthesis of other compounds.
Used in Industrial Applications:
While specific uses in industry are not detailed in the provided materials, the compound's unique structure and properties may find applications in various industrial processes, potentially including the development of new materials or as intermediates in chemical synthesis, pending further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1012-35-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,1 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1012-35:
(6*1)+(5*0)+(4*1)+(3*2)+(2*3)+(1*5)=27
27 % 10 = 7
So 1012-35-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O3/c1-6(12)11-8(14)10-7(13)9(11)4-2-3-5-9/h2-5H2,1H3,(H,10,13,14)