101224-99-1 Usage
Description
C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) is a complex organometallic compound that features a ferrocene core with two carbon monoxide ligands attached to the iron atom. The molecule is further elaborated with a cyclohexenyl group and two ether groups, which contribute to its unique chemical properties. C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) may hold potential for various applications in fields such as organic synthesis, catalysis, and as a ligand for the formation of other metal complexes.
Uses
Used in Organic Synthesis:
C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) is used as a synthetic intermediate for the preparation of other organometallic compounds and organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Catalysis:
In the field of catalysis, C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) is used as a catalyst or a catalyst precursor. Its ability to bind and activate substrates, along with its potential to transfer metal centers, makes it a promising candidate for catalyzing various chemical reactions, including hydrogenation, oxidation, and carbonylation processes.
Used as a Ligand in Metal Complexes:
C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) is utilized as a ligand in the formation of metal complexes, where it can influence the properties and reactivity of the resulting complexes. Its presence can modulate the electronic and steric environment around the metal center, which is crucial for applications in homogeneous catalysis, materials science, and medicinal chemistry.
Used in Pharmaceutical Industry:
C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) may be employed as a pharmaceutical agent or a building block for drug development. Its organometallic nature and potential interactions with biological targets could lead to the discovery of new drugs with unique mechanisms of action.
Used in Materials Science:
In the realm of materials science, C5H5Fe(CO)2(CHCH(C6H9O)O(CHCH3)2O) is used in the development of advanced materials with specific properties, such as conductivity, magnetism, or catalytic activity. Its incorporation into polymers, nanoparticles, or other materials can lead to novel applications in sensors, energy storage, or environmental remediation.
Check Digit Verification of cas no
The CAS Registry Mumber 101224-99-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,2,2 and 4 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 101224-99:
(8*1)+(7*0)+(6*1)+(5*2)+(4*2)+(3*4)+(2*9)+(1*9)=71
71 % 10 = 1
So 101224-99-1 is a valid CAS Registry Number.
101224-99-1Relevant articles and documents
Asymmetric carbon-carbon bond formation using optically active (η-C5H5)Fe(CO)2-vinyl ether complexes. Asymmetric control at two adjacent carbon centers
Rosenblum, Myron,Turnbull, Mark M.,Foxman, Bruce M.
, p. 1062 - 1063 (2008/10/08)
The dihydrodioxin-Fp complex 2b (Fp = (η-C5H5)Fe(CO)2) adds a broad range of nucleophiles to give optically active adducts 4 in which nucleophile and Fp group are diaxial. These may be converted to optically active Fp(η2-vinyl ether) or Fp(η2-alkene) cations of defined absolute configuration.
