10136-64-8 Usage
General Description
6-PHENYL-IMIDAZO[2,1-B][1,3,4]THIADIAZOL-2-YLAMINE is a chemical compound with a complex molecular structure that contains a phenyl group and an imidazole ring linked to a thiadiazole ring. It is a yellowish powder with a molecular formula C10H7N5S and a molecular weight of 221.26 g/mol. 6-PHENYL-IMIDAZO[2,1-B][1,3,4]THIADIAZOL-2-YLAMINE has potential applications in the field of medicinal chemistry due to its unique structure and potential biological activities. It may be used in the development of pharmaceuticals or as a building block for the synthesis of other related compounds. Its specific properties and potential uses would need to be further characterized through research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 10136-64-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,3 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10136-64:
(7*1)+(6*0)+(5*1)+(4*3)+(3*6)+(2*6)+(1*4)=58
58 % 10 = 8
So 10136-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4S/c11-9-13-14-6-8(12-10(14)15-9)7-4-2-1-3-5-7/h1-6H,(H2,11,13)
