101377-34-8 Usage
General Description
1,19-bis(oxiranyl)-8,16-bis(oxiranylmethoxy)-2,6,10,14,18-pentaoxanonadecane-4,12-diol is a complex chemical compound with a long, descriptive name that indicates its structure and composition. It is a diol, meaning it contains two hydroxyl (OH) functional groups, and it also contains multiple epoxide (oxiranyl) groups. The compound has a long hydrocarbon backbone with multiple oxygen atoms, giving it the potential to form strong hydrogen bonding interactions. Due to its complex structure and functional groups, 1,19-bis(oxiranyl)-8,16-bis(oxiranylmethoxy)-2,6,10,14,18-pentaoxanonadecane-4,12-diol likely has applications in various chemical and biological processes, such as polymerization, organic synthesis, and potentially even as a pharmaceutical compound. However, its exact uses and properties would need to be studied and determined through further experimentation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 101377-34-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,3,7 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 101377-34:
(8*1)+(7*0)+(6*1)+(5*3)+(4*7)+(3*7)+(2*3)+(1*4)=88
88 % 10 = 8
So 101377-34-8 is a valid CAS Registry Number.
InChI:InChI=1/C24H42O13/c25-17(2-29-7-20(33-14-24-16-37-24)8-31-10-22-12-35-22)1-27-5-19(32-13-23-15-36-23)6-28-3-18(26)4-30-9-21-11-34-21/h17-26H,1-16H2