101418-04-6 Usage
General Description
1-[9-[3-(4-ethoxy-3,4,5,6-tetrahydro-2H-pyridin-1-yl)propyl]carbazol-2-yl]ethanone chloride is a chemical compound with a complex structure. It contains a carbazole ring with a 2-yl ethanone group attached to it. Additionally, it has a 3-(4-ethoxy-3,4,5,6-tetrahydro-2H-pyridin-1-yl)propyl side chain. The compound also contains a chloride ion. This chemical has potential applications in organic synthesis, pharmaceuticals, and materials science, but further research may be needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 101418-04-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,4,1 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 101418-04:
(8*1)+(7*0)+(6*1)+(5*4)+(4*1)+(3*8)+(2*0)+(1*4)=66
66 % 10 = 6
So 101418-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N2O2.ClH/c1-3-28-20-11-15-25(16-12-20)13-6-14-26-23-8-5-4-7-21(23)22-10-9-19(18(2)27)17-24(22)26;/h4-5,7-10,17,20H,3,6,11-16H2,1-2H3;1H