10155-48-3 Usage
Description
7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide is a complex organic chemical compound characterized by a naphthalene backbone, a carboxamide functional group, and the presence of a bromine atom, a hydroxyl group, and a morpholine moiety. Its structural features suggest potential for hydrogen bonding and solubility, with the morpholine moiety possibly contributing unique pharmacological properties. 7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide holds promise for pharmaceutical research and drug development due to its capacity to interact with biological targets.
Uses
Used in Pharmaceutical Research and Drug Development:
7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide is used as a potential candidate in pharmaceutical research and drug development for its structural features that allow for interactions with biological targets. The presence of the carboxamide group suggests it may engage in hydrogen bonding, which is crucial for molecular recognition and binding. Additionally, the hydroxyl group could enhance its solubility, an important factor in drug formulation and delivery. The morpholine moiety may also impart specific pharmacological properties, making it a versatile compound for the development of new therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide is used as a structural template for the design of new drugs. Its unique combination of functional groups and substituents can be further modified to optimize its pharmacokinetic and pharmacodynamic properties, potentially leading to the discovery of novel therapeutic agents with improved efficacy and safety profiles.
Used in Biochemical Studies:
7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide is used as a tool compound in biochemical studies to investigate the binding interactions between small molecules and biological macromolecules, such as proteins and nucleic acids. Understanding these interactions can provide insights into the molecular mechanisms of diseases and aid in the development of targeted therapies.
Used in Chemical Synthesis:
In chemical synthesis, 7-bromo-3-hydroxy-N-[3-(morpholin-4-yl)propyl]naphthalene-2-carboxamide serves as a starting material or intermediate for the preparation of more complex organic molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Note: The specific applications in different industries and the reasons for their use would require more detailed information about the compound's properties and potential interactions with biological systems. The provided uses are based on the general structural features and potential of the compound as inferred from its chemical structure.
Check Digit Verification of cas no
The CAS Registry Mumber 10155-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,5 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10155-48:
(7*1)+(6*0)+(5*1)+(4*5)+(3*5)+(2*4)+(1*8)=63
63 % 10 = 3
So 10155-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H21BrN2O3/c19-15-3-2-13-12-17(22)16(11-14(13)10-15)18(23)20-4-1-5-21-6-8-24-9-7-21/h2-3,10-12,22H,1,4-9H2,(H,20,23)