10158-72-2 Usage
Uses
Used in Organic Synthesis:
(3,6-DIOXO-3,6-DIHYDROPYRIDAZIN-1(2H)-YL)ACETIC ACID is used as a building block in organic synthesis for the creation of various compounds. Its unique pyridazine ring structure allows for the development of a wide range of chemical entities with diverse applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (3,6-DIOXO-3,6-DIHYDROPYRIDAZIN-1(2H)-YL)ACETIC ACID is used as a key intermediate in the synthesis of new drugs. Its presence in the molecular structure can contribute to the pharmacological properties of the final drug product, making it a valuable component in drug discovery and development.
Used as an Antibacterial Agent:
(3,6-DIOXO-3,6-DIHYDROPYRIDAZIN-1(2H)-YL)ACETIC ACID has shown potential as an antibacterial agent in research studies. It can be used for the development of new antibiotics to combat bacterial infections, particularly in cases where existing treatments are ineffective.
Used as an Antitumor Agent:
(3,6-DIOXO-3,6-DIHYDROPYRIDAZIN-1(2H)-YL)ACETIC ACID has also demonstrated potential as an antitumor agent, making it a candidate for further research and development in oncology. Its use in cancer treatment could involve targeting specific tumor cells or enhancing the effectiveness of existing cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 10158-72-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,5 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10158-72:
(7*1)+(6*0)+(5*1)+(4*5)+(3*8)+(2*7)+(1*2)=72
72 % 10 = 2
So 10158-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O4/c9-4-1-2-5(10)8(7-4)3-6(11)12/h1-2H,3H2,(H,7,9)(H,11,12)/p-1
