101602-77-1 Usage
General Description
1-(3-Indolylmethyl)nipecotic acid ethyl ester is a chemical compound that belongs to the family of nipecotic acid esters. It is a derivative of nipecotic acid, which is known to act as a GABA uptake inhibitor in the brain. The ethyl ester form of this compound increases its lipophilicity, making it more readily able to cross the blood-brain barrier. This property could potentially enhance its therapeutic effects in the central nervous system. Additionally, the indolylmethyl moiety in the compound suggests potential interactions with serotonin receptors in the brain, which may further contribute to its pharmacological properties. Overall, 1-(3-Indolylmethyl)nipecotic acid ethyl ester has potential as a central nervous system drug and deserves further investigation for its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 101602-77-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,6,0 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 101602-77:
(8*1)+(7*0)+(6*1)+(5*6)+(4*0)+(3*2)+(2*7)+(1*7)=71
71 % 10 = 1
So 101602-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H22N2O2/c1-2-21-17(20)13-6-5-9-19(11-13)12-14-10-18-16-8-4-3-7-15(14)16/h3-4,7-8,10,13,18H,2,5-6,9,11-12H2,1H3