101607-48-1 Usage
General Description
10-Methyl-1,2-tetrahydro-1,2:5,6-benzacridine is a chemical compound with a complex molecular structure. It belongs to the class of tetrahydrobenzacridines, which are known for their potential pharmacological properties. This specific compound consists of a benzene ring fused with a central seven-membered ring. The presence of a methyl group at the 10th position further contributes to its unique chemical properties. While its exact applications and uses may vary, compounds with similar structures have been studied for their potential as pharmaceutical agents, including anti-tumor and anti-inflammatory properties. However, due to its complex nature, further research and testing would be needed to fully understand its potential benefits and risks.
Check Digit Verification of cas no
The CAS Registry Mumber 101607-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,6,0 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 101607-48:
(8*1)+(7*0)+(6*1)+(5*6)+(4*0)+(3*7)+(2*4)+(1*8)=81
81 % 10 = 1
So 101607-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H19N/c1-14-17-12-10-16-7-3-5-9-19(16)22(17)23-20-13-11-15-6-2-4-8-18(15)21(14)20/h2,4,6,8,10-13H,3,5,7,9H2,1H3